C13H18N2S — CID 143208260
4-[[2-[(Z)-but-2-enyl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione (PubChem CID 143208260) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 4-[[2-[(Z)-but-2-enyl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[[2-[(Z)-but-2-enyl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 143208260 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-[[2-[(Z)-but-2-enyl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione |
| SMILES | C/C=C\CC1=CCCC1Cc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C13H18N2S/c1-2-3-5-10-6-4-7-11(10)8-12-9-14-13(16)15-12/h2-3,6,9,11H,4-5,7-8H2,1H3,(H2,14,15,16)/b3-2- |
| InChIKey | FEWABHJVXYNIQH-IHWYPQMZSA-N |
| XLogP | 3.92 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|