C17H24N2S — CID 143208342
acetylene;4-[(3E)-3-[(Z)-but-2-enyl]octa-3,7-dien-2-yl]-1,3-dihydroimidazole-2-thione (PubChem CID 143208342) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is acetylene;4-[(3E)-3-[(Z)-but-2-enyl]octa-3,7-dien-2-yl]-1,3-dihydroimidazole-2-thione.
| Compound Name | acetylene;4-[(3E)-3-[(Z)-but-2-enyl]octa-3,7-dien-2-yl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 143208342 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | acetylene;4-[(3E)-3-[(Z)-but-2-enyl]octa-3,7-dien-2-yl]-1,3-dihydroimidazole-2-thione |
| SMILES | C#C.C=CCC/C=C(\C/C=C\C)C(C)c1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C15H22N2S.C2H2/c1-4-6-8-10-13(9-7-5-2)12(3)14-11-16-15(18)17-14;1-2/h4-5,7,10-12H,1,6,8-9H2,2-3H3,(H2,16,17,18);1-2H/b7-5-,13-10+; |
| InChIKey | XHBQVWPHCKNLKL-OPMJDEGMSA-N |
| XLogP | 5.28 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|