C19H32N2S — CID 143208259
(Z)-but-2-ene;4-[[2-[(Z)-but-2-enyl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione;ethane (PubChem CID 143208259) has the molecular formula C19H32N2S and a molecular weight of 320.55 g/mol. Its IUPAC name is (Z)-but-2-ene;4-[[2-[(Z)-but-2-enyl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione;ethane.
| Compound Name | (Z)-but-2-ene;4-[[2-[(Z)-but-2-enyl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione;ethane |
|---|---|
| PubChem CID | 143208259 |
| Molecular Formula | C19H32N2S |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | (Z)-but-2-ene;4-[[2-[(Z)-but-2-enyl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione;ethane |
| SMILES | C/C=C\C.C/C=C\CC1=CCCC1Cc1c[nH]c(=S)[nH]1.CC |
| InChI | InChI=1S/C13H18N2S.C4H8.C2H6/c1-2-3-5-10-6-4-7-11(10)8-12-9-14-13(16)15-12;1-3-4-2;1-2/h2-3,6,9,11H,4-5,7-8H2,1H3,(H2,14,15,16);3-4H,1-2H3;1-2H3/b3-2-;4-3-; |
| InChIKey | MAJSISKBUGDIRD-NISGKDEJSA-N |
| XLogP | 6.53 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|