C18H26F2N2S — CID 143208296
[(7E,9Z,10E)-11-fluoro-9-(2-fluoroethylidene)-4,7-dimethyltrideca-1,7,10,12-tetraen-2-yl]thiourea (PubChem CID 143208296) has the molecular formula C18H26F2N2S and a molecular weight of 340.48 g/mol. Its IUPAC name is [(7E,9Z,10E)-11-fluoro-9-(2-fluoroethylidene)-4,7-dimethyltrideca-1,7,10,12-tetraen-2-yl]thiourea.
| Compound Name | [(7E,9Z,10E)-11-fluoro-9-(2-fluoroethylidene)-4,7-dimethyltrideca-1,7,10,12-tetraen-2-yl]thiourea |
|---|---|
| PubChem CID | 143208296 |
| Molecular Formula | C18H26F2N2S |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [(7E,9Z,10E)-11-fluoro-9-(2-fluoroethylidene)-4,7-dimethyltrideca-1,7,10,12-tetraen-2-yl]thiourea |
| SMILES | C=C/C(F)=C\C(=C/CF)\C=C(/C)CCC(C)CC(=C)NC(N)=S |
| InChI | InChI=1S/C18H26F2N2S/c1-5-17(20)12-16(8-9-19)11-14(3)7-6-13(2)10-15(4)22-18(21)23/h5,8,11-13H,1,4,6-7,9-10H2,2-3H3,(H3,21,22,23)/b14-11+,16-8-,17-12+ |
| InChIKey | LONCYFCNSXAHHI-MRNHCRLTSA-N |
| XLogP | 5.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|