C14H24N2S — CID 64863746
3-[(2-methylcyclohexyl)methyl]-4-propan-2-yl-1H-imidazole-2-thione (PubChem CID 64863746) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is 3-[(2-methylcyclohexyl)methyl]-4-propan-2-yl-1H-imidazole-2-thione.
| Compound Name | 3-[(2-methylcyclohexyl)methyl]-4-propan-2-yl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 64863746 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 3-[(2-methylcyclohexyl)methyl]-4-propan-2-yl-1H-imidazole-2-thione |
| SMILES | CC(C)c1c[nH]c(=S)n1CC1CCCCC1C |
| InChI | InChI=1S/C14H24N2S/c1-10(2)13-8-15-14(17)16(13)9-12-7-5-4-6-11(12)3/h8,10-12H,4-7,9H2,1-3H3,(H,15,17) |
| InChIKey | LBDZKBBFOLDJHH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|