C16H27N3S — CID 156632478
2-[2-[[(1R)-1-cyclohexylethyl]amino]ethyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione (PubChem CID 156632478) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is 2-[2-[[(1R)-1-cyclohexylethyl]amino]ethyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | 2-[2-[[(1R)-1-cyclohexylethyl]amino]ethyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 156632478 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-[2-[[(1R)-1-cyclohexylethyl]amino]ethyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione |
| SMILES | C[C@@H](NCCn1cc2n(c1=S)CCC2)C1CCCCC1 |
| InChI | InChI=1S/C16H27N3S/c1-13(14-6-3-2-4-7-14)17-9-11-18-12-15-8-5-10-19(15)16(18)20/h12-14,17H,2-11H2,1H3/t13-/m1/s1 |
| InChIKey | SJSVUAYQGAUGCS-CYBMUJFWSA-N |
| XLogP | 3.52 |
| TPSA | 21.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|