C19H25F3N4O3S — CID 134385083
5-methyl-3-(2-methylcyclopropyl)-6-(1,3,6-oxadiazepan-3-ylmethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 134385083) has the molecular formula C19H25F3N4O3S and a molecular weight of 446.50 g/mol. Its IUPAC name is 5-methyl-3-(2-methylcyclopropyl)-6-(1,3,6-oxadiazepan-3-ylmethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-3-(2-methylcyclopropyl)-6-(1,3,6-oxadiazepan-3-ylmethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134385083 |
| Molecular Formula | C19H25F3N4O3S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 5-methyl-3-(2-methylcyclopropyl)-6-(1,3,6-oxadiazepan-3-ylmethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(CN2CCNCOC2)sc2c1c(=O)n(C1CC1C)c(=O)n2CCC(F)(F)F |
| InChI | InChI=1S/C19H25F3N4O3S/c1-11-7-13(11)26-16(27)15-12(2)14(8-24-6-4-23-9-29-10-24)30-17(15)25(18(26)28)5-3-19(20,21)22/h11,13,23H,3-10H2,1-2H3 |
| InChIKey | AMUCNFTUDQIIAG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |