C18H21F6N5O2S — CID 137276730
5-methyl-6-[(2-methyliminoimidazolidin-1-yl)methyl]-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 137276730) has the molecular formula C18H21F6N5O2S and a molecular weight of 485.45 g/mol. Its IUPAC name is 5-methyl-6-[(2-methyliminoimidazolidin-1-yl)methyl]-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-6-[(2-methyliminoimidazolidin-1-yl)methyl]-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137276730 |
| Molecular Formula | C18H21F6N5O2S |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 5-methyl-6-[(2-methyliminoimidazolidin-1-yl)methyl]-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | C/N=C1\NCCN1Cc1sc2c(c1C)c(=O)n(C(C)C(F)(F)F)c(=O)n2CCC(F)(F)F |
| InChI | InChI=1S/C18H21F6N5O2S/c1-9-11(8-27-7-5-26-15(27)25-3)32-14-12(9)13(30)29(10(2)18(22,23)24)16(31)28(14)6-4-17(19,20)21/h10H,4-8H2,1-3H3,(H,25,26) |
| InChIKey | LHMPKMRZQLKJLI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|