C14H16F3N3O3S — CID 140848218
6-[(E)-hydroxyiminomethyl]-5-methyl-3-propan-2-yl-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 140848218) has the molecular formula C14H16F3N3O3S and a molecular weight of 363.36 g/mol. Its IUPAC name is 6-[(E)-hydroxyiminomethyl]-5-methyl-3-propan-2-yl-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-[(E)-hydroxyiminomethyl]-5-methyl-3-propan-2-yl-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140848218 |
| Molecular Formula | C14H16F3N3O3S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 6-[(E)-hydroxyiminomethyl]-5-methyl-3-propan-2-yl-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(/C=N/O)sc2c1c(=O)n(C(C)C)c(=O)n2CCC(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O3S/c1-7(2)20-11(21)10-8(3)9(6-18-23)24-12(10)19(13(20)22)5-4-14(15,16)17/h6-7,23H,4-5H2,1-3H3/b18-6+ |
| InChIKey | NWZHQSLDPGGYSB-NGYBGAFCSA-N |
| XLogP | 2.87 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|