C19H22F6N4O4S — CID 134322325
tert-butyl N-[(E)-[5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate (PubChem CID 134322325) has the molecular formula C19H22F6N4O4S and a molecular weight of 516.46 g/mol. Its IUPAC name is tert-butyl N-[(E)-[5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-[5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 134322325 |
| Molecular Formula | C19H22F6N4O4S |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | tert-butyl N-[(E)-[5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate |
| SMILES | Cc1c(/C=N/NC(=O)OC(C)(C)C)sc2c1c(=O)n(C(C)C(F)(F)F)c(=O)n2CCC(F)(F)F |
| InChI | InChI=1S/C19H22F6N4O4S/c1-9-11(8-26-27-15(31)33-17(3,4)5)34-14-12(9)13(30)29(10(2)19(23,24)25)16(32)28(14)7-6-18(20,21)22/h8,10H,6-7H2,1-5H3,(H,27,31)/b26-8+ |
| InChIKey | MDYUOOREFDJAHO-MWRNPHMMSA-N |
| XLogP | 4.47 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|