C18H26N4O5S — CID 134322125
tert-butyl N-[(E)-[3-ethyl-1-(2-methoxyethyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate (PubChem CID 134322125) has the molecular formula C18H26N4O5S and a molecular weight of 410.50 g/mol. Its IUPAC name is tert-butyl N-[(E)-[3-ethyl-1-(2-methoxyethyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-[3-ethyl-1-(2-methoxyethyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 134322125 |
| Molecular Formula | C18H26N4O5S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | tert-butyl N-[(E)-[3-ethyl-1-(2-methoxyethyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate |
| SMILES | CCn1c(=O)c2c(C)c(/C=N/NC(=O)OC(C)(C)C)sc2n(CCOC)c1=O |
| InChI | InChI=1S/C18H26N4O5S/c1-7-21-14(23)13-11(2)12(10-19-20-16(24)27-18(3,4)5)28-15(13)22(17(21)25)8-9-26-6/h10H,7-9H2,1-6H3,(H,20,24)/b19-10+ |
| InChIKey | ZRSBAQUNVJSGEK-VXLYETTFSA-N |
| XLogP | 2.06 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|