C21H29N3O5S — CID 160641603
tert-butyl 2-[[3-cyclopropyl-1-(2-ethoxyethyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]acetate (PubChem CID 160641603) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is tert-butyl 2-[[3-cyclopropyl-1-(2-ethoxyethyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]acetate.
| Compound Name | tert-butyl 2-[[3-cyclopropyl-1-(2-ethoxyethyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]acetate |
|---|---|
| PubChem CID | 160641603 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | tert-butyl 2-[[3-cyclopropyl-1-(2-ethoxyethyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]acetate |
| SMILES | CCOCCn1c(=O)n(C2CC2)c(=O)c2c(C)c(/C=N/CC(=O)OC(C)(C)C)sc21 |
| InChI | InChI=1S/C21H29N3O5S/c1-6-28-10-9-23-19-17(18(26)24(20(23)27)14-7-8-14)13(2)15(30-19)11-22-12-16(25)29-21(3,4)5/h11,14H,6-10,12H2,1-5H3/b22-11+ |
| InChIKey | RJGBODBVNUMDMF-SSDVNMTOSA-N |
| XLogP | 2.67 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|