C22H28F2N4O4S — CID 134367397
tert-butyl N-[[3-cyclopropyl-1-[(3,3-difluorocyclopentyl)methyl]-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate (PubChem CID 134367397) has the molecular formula C22H28F2N4O4S and a molecular weight of 482.55 g/mol. Its IUPAC name is tert-butyl N-[[3-cyclopropyl-1-[(3,3-difluorocyclopentyl)methyl]-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[[3-cyclopropyl-1-[(3,3-difluorocyclopentyl)methyl]-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 134367397 |
| Molecular Formula | C22H28F2N4O4S |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | tert-butyl N-[[3-cyclopropyl-1-[(3,3-difluorocyclopentyl)methyl]-5-methyl-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate |
| SMILES | Cc1c(C=NNC(=O)OC(C)(C)C)sc2c1c(=O)n(C1CC1)c(=O)n2CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C22H28F2N4O4S/c1-12-15(10-25-26-19(30)32-21(2,3)4)33-18-16(12)17(29)28(14-5-6-14)20(31)27(18)11-13-7-8-22(23,24)9-13/h10,13-14H,5-9,11H2,1-4H3,(H,26,30) |
| InChIKey | YKGUQWAAJZTRKO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|