C19H23N5O4S — CID 134384526
tert-butyl N-[(E)-[1-(cyanomethyl)-5-methyl-3-(1-methylcyclopropyl)-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate (PubChem CID 134384526) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is tert-butyl N-[(E)-[1-(cyanomethyl)-5-methyl-3-(1-methylcyclopropyl)-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-[1-(cyanomethyl)-5-methyl-3-(1-methylcyclopropyl)-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 134384526 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | tert-butyl N-[(E)-[1-(cyanomethyl)-5-methyl-3-(1-methylcyclopropyl)-2,4-dioxothieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate |
| SMILES | Cc1c(/C=N/NC(=O)OC(C)(C)C)sc2c1c(=O)n(C1(C)CC1)c(=O)n2CC#N |
| InChI | InChI=1S/C19H23N5O4S/c1-11-12(10-21-22-16(26)28-18(2,3)4)29-15-13(11)14(25)24(19(5)6-7-19)17(27)23(15)9-8-20/h10H,6-7,9H2,1-5H3,(H,22,26)/b21-10+ |
| InChIKey | MWBZTQBPJCVMLP-UFFVCSGVSA-N |
| XLogP | 2.42 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|