C19H24F2N4O2S — CID 150935825
6-[(tert-butylhydrazinylidene)methyl]-3-cyclopropyl-1-[(2,2-difluorocyclopropyl)methyl]-5-methylthieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 150935825) has the molecular formula C19H24F2N4O2S and a molecular weight of 410.49 g/mol. Its IUPAC name is 6-[(tert-butylhydrazinylidene)methyl]-3-cyclopropyl-1-[(2,2-difluorocyclopropyl)methyl]-5-methylthieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-[(tert-butylhydrazinylidene)methyl]-3-cyclopropyl-1-[(2,2-difluorocyclopropyl)methyl]-5-methylthieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 150935825 |
| Molecular Formula | C19H24F2N4O2S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 6-[(tert-butylhydrazinylidene)methyl]-3-cyclopropyl-1-[(2,2-difluorocyclopropyl)methyl]-5-methylthieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(C=NNC(C)(C)C)sc2c1c(=O)n(C1CC1)c(=O)n2CC1CC1(F)F |
| InChI | InChI=1S/C19H24F2N4O2S/c1-10-13(8-22-23-18(2,3)4)28-16-14(10)15(26)25(12-5-6-12)17(27)24(16)9-11-7-19(11,20)21/h8,11-12,23H,5-7,9H2,1-4H3 |
| InChIKey | LGZVDCBXCLXIOP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|