C15H17FN2O3S — CID 134385010
3-cyclopropyl-1-(4-fluorobutyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 134385010) has the molecular formula C15H17FN2O3S and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-cyclopropyl-1-(4-fluorobutyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 3-cyclopropyl-1-(4-fluorobutyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 134385010 |
| Molecular Formula | C15H17FN2O3S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 3-cyclopropyl-1-(4-fluorobutyl)-5-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | Cc1c(C=O)sc2c1c(=O)n(C1CC1)c(=O)n2CCCCF |
| InChI | InChI=1S/C15H17FN2O3S/c1-9-11(8-19)22-14-12(9)13(20)18(10-4-5-10)15(21)17(14)7-3-2-6-16/h8,10H,2-7H2,1H3 |
| InChIKey | RWPIJKIRRLEXPM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|