C10H10N2O3S — CID 20692617
1,3,5-trimethyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 20692617) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 1,3,5-trimethyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 1,3,5-trimethyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 20692617 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1,3,5-trimethyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | Cc1c(C=O)sc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H10N2O3S/c1-5-6(4-13)16-9-7(5)8(14)11(2)10(15)12(9)3/h4H,1-3H3 |
| InChIKey | HJXJCSMYRDEKFT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|