C11H14I2N2O2S — CID 157445527
5-ethyl-1,3,6-trimethylthieno[2,3-d]pyrimidine-2,4-dione;molecular iodine (PubChem CID 157445527) has the molecular formula C11H14I2N2O2S and a molecular weight of 492.12 g/mol. Its IUPAC name is 5-ethyl-1,3,6-trimethylthieno[2,3-d]pyrimidine-2,4-dione;molecular iodine.
| Compound Name | 5-ethyl-1,3,6-trimethylthieno[2,3-d]pyrimidine-2,4-dione;molecular iodine |
|---|---|
| PubChem CID | 157445527 |
| Molecular Formula | C11H14I2N2O2S |
| Molecular Weight | 492.12 g/mol |
| Exact Mass | 491.89 |
| IUPAC Name | 5-ethyl-1,3,6-trimethylthieno[2,3-d]pyrimidine-2,4-dione;molecular iodine |
| SMILES | CCc1c(C)sc2c1c(=O)n(C)c(=O)n2C.II |
| InChI | InChI=1S/C11H14N2O2S.I2/c1-5-7-6(2)16-10-8(7)9(14)12(3)11(15)13(10)4;1-2/h5H2,1-4H3; |
| InChIKey | BSEFBLVWDAEWRU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|