C12H14Br2N2O2S — CID 122543882
6-bromo-5-(bromomethyl)-3-butyl-1-methylthieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 122543882) has the molecular formula C12H14Br2N2O2S and a molecular weight of 410.13 g/mol. Its IUPAC name is 6-bromo-5-(bromomethyl)-3-butyl-1-methylthieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-bromo-5-(bromomethyl)-3-butyl-1-methylthieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 122543882 |
| Molecular Formula | C12H14Br2N2O2S |
| Molecular Weight | 410.13 g/mol |
| Exact Mass | 407.91 |
| IUPAC Name | 6-bromo-5-(bromomethyl)-3-butyl-1-methylthieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(=O)c2c(CBr)c(Br)sc2n(C)c1=O |
| InChI | InChI=1S/C12H14Br2N2O2S/c1-3-4-5-16-10(17)8-7(6-13)9(14)19-11(8)15(2)12(16)18/h3-6H2,1-2H3 |
| InChIKey | SYMGTTCDZDOAAC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.13 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|