About CID 159884033
CID 159884033 (PubChem CID 159884033) has the molecular formula C24H32BBrN5O4S3
and a molecular weight of 641.47 g/mol.
Molecular Properties
| Compound Name | CID 159884033 |
| PubChem CID | 159884033 |
| Molecular Formula | C24H32BBrN5O4S3 |
| Molecular Weight | 641.47 g/mol |
| Exact Mass | 640.09 |
| IUPAC Name | — |
| SMILES | CCCCn1c(=O)c2c(C)c(Br)sc2n(C)c1=O.CCCCn1c(=O)c2c(C)csc2n(C)c1=O.[B]=NS |
| InChI | InChI=1S/C12H15BrN2O2S.C12H16N2O2S.BHNS/c1-4-5-6-15-10(16)8-7(2)9(13)18-11(8)14(3)12(15)17;1-4-5-6-14-10(15)9-8(2)7-17-11(9)13(3)12(14)16;1-2-3/h4-6H2,1-3H3;7H,4-6H2,1-3H3;3H |
| InChIKey | XWRNGZMSBNXXOH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 641.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 159884033 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159884033?
The IUPAC name of CID 159884033 (CID 159884033) is not available.
What is the SMILES notation for CID 159884033?
The canonical SMILES for CID 159884033 is CCCCn1c(=O)c2c(C)c(Br)sc2n(C)c1=O.CCCCn1c(=O)c2c(C)csc2n(C)c1=O.[B]=NS.
What is the InChIKey of CID 159884033?
The InChIKey is XWRNGZMSBNXXOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN2O2S.C12H16N2O2S.BHNS/c1-4-5-6-15-10(16)8-7(2)9(13)18-11(8)14(3)12(15)17;1-4-5-6-14-10(15)9-8(2)7-17-11(9)13(3)12(14)16;1-2-3/h4-6H2,1-3H3;7H,4-6H2,1-3H3;3H.
What are the key properties of CID 159884033?
CID 159884033 has a molecular weight of 641.47 g/mol, XLogP of 4.69, 6 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159884033 is sourced from PubChem (CID 159884033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).