C24H32BBrN5O4S3 — CID 159884033
CID 159884033 (PubChem CID 159884033) has the molecular formula C24H32BBrN5O4S3 and a molecular weight of 641.47 g/mol.
| Compound Name | CID 159884033 |
|---|---|
| PubChem CID | 159884033 |
| Molecular Formula | C24H32BBrN5O4S3 |
| Molecular Weight | 641.47 g/mol |
| Exact Mass | 640.09 |
| IUPAC Name | — |
| SMILES | CCCCn1c(=O)c2c(C)c(Br)sc2n(C)c1=O.CCCCn1c(=O)c2c(C)csc2n(C)c1=O.[B]=NS |
| InChI | InChI=1S/C12H15BrN2O2S.C12H16N2O2S.BHNS/c1-4-5-6-15-10(16)8-7(2)9(13)18-11(8)14(3)12(15)17;1-4-5-6-14-10(15)9-8(2)7-17-11(9)13(3)12(14)16;1-2-3/h4-6H2,1-3H3;7H,4-6H2,1-3H3;3H |
| InChIKey | XWRNGZMSBNXXOH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|