C14H12F6N2O3S — CID 134305458
5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 134305458) has the molecular formula C14H12F6N2O3S and a molecular weight of 402.32 g/mol. Its IUPAC name is 5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 134305458 |
| Molecular Formula | C14H12F6N2O3S |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | Cc1c(C=O)sc2c1c(=O)n(C(C)C(F)(F)F)c(=O)n2CCC(F)(F)F |
| InChI | InChI=1S/C14H12F6N2O3S/c1-6-8(5-23)26-11-9(6)10(24)22(7(2)14(18,19)20)12(25)21(11)4-3-13(15,16)17/h5,7H,3-4H2,1-2H3 |
| InChIKey | DGIMZXQYVDUNKP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|