C17H17F2N5O3S — CID 137277972
3-cyclopropyl-1-[(2,2-difluorocyclopropyl)methyl]-5-methyl-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 137277972) has the molecular formula C17H17F2N5O3S and a molecular weight of 409.42 g/mol. Its IUPAC name is 3-cyclopropyl-1-[(2,2-difluorocyclopropyl)methyl]-5-methyl-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-cyclopropyl-1-[(2,2-difluorocyclopropyl)methyl]-5-methyl-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137277972 |
| Molecular Formula | C17H17F2N5O3S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 3-cyclopropyl-1-[(2,2-difluorocyclopropyl)methyl]-5-methyl-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(Cn2nc[nH]c2=O)sc2c1c(=O)n(C1CC1)c(=O)n2CC1CC1(F)F |
| InChI | InChI=1S/C17H17F2N5O3S/c1-8-11(6-23-15(26)20-7-21-23)28-14-12(8)13(25)24(10-2-3-10)16(27)22(14)5-9-4-17(9,18)19/h7,9-10H,2-6H2,1H3,(H,20,21,26) |
| InChIKey | YXOIAQMUQMSHRK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |