C19H21F2N5O3S — CID 137288991
3-cyclopropyl-1-[(3,3-difluorocyclopentyl)methyl]-5-methyl-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 137288991) has the molecular formula C19H21F2N5O3S and a molecular weight of 437.47 g/mol. Its IUPAC name is 3-cyclopropyl-1-[(3,3-difluorocyclopentyl)methyl]-5-methyl-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-cyclopropyl-1-[(3,3-difluorocyclopentyl)methyl]-5-methyl-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137288991 |
| Molecular Formula | C19H21F2N5O3S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-cyclopropyl-1-[(3,3-difluorocyclopentyl)methyl]-5-methyl-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(Cn2nc[nH]c2=O)sc2c1c(=O)n(C1CC1)c(=O)n2CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C19H21F2N5O3S/c1-10-13(8-25-17(28)22-9-23-25)30-16-14(10)15(27)26(12-2-3-12)18(29)24(16)7-11-4-5-19(20,21)6-11/h9,11-12H,2-8H2,1H3,(H,22,23,28) |
| InChIKey | NLBKDVBCCYTLAH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |