C18H19F2N5O3S — CID 137277982
1-[(2,2-difluorocyclopropyl)methyl]-5-methyl-3-(1-methylcyclopropyl)-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 137277982) has the molecular formula C18H19F2N5O3S and a molecular weight of 423.45 g/mol. Its IUPAC name is 1-[(2,2-difluorocyclopropyl)methyl]-5-methyl-3-(1-methylcyclopropyl)-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[(2,2-difluorocyclopropyl)methyl]-5-methyl-3-(1-methylcyclopropyl)-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137277982 |
| Molecular Formula | C18H19F2N5O3S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1-[(2,2-difluorocyclopropyl)methyl]-5-methyl-3-(1-methylcyclopropyl)-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(Cn2nc[nH]c2=O)sc2c1c(=O)n(C1(C)CC1)c(=O)n2CC1CC1(F)F |
| InChI | InChI=1S/C18H19F2N5O3S/c1-9-11(7-24-15(27)21-8-22-24)29-14-12(9)13(26)25(17(2)3-4-17)16(28)23(14)6-10-5-18(10,19)20/h8,10H,3-7H2,1-2H3,(H,21,22,27) |
| InChIKey | RVHNXAJRILAEAG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |