C17H18F3N5O4S — CID 137026473
5-methyl-1-(oxolan-2-ylmethyl)-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]-3-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 137026473) has the molecular formula C17H18F3N5O4S and a molecular weight of 445.42 g/mol. Its IUPAC name is 5-methyl-1-(oxolan-2-ylmethyl)-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]-3-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-(oxolan-2-ylmethyl)-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]-3-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137026473 |
| Molecular Formula | C17H18F3N5O4S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 5-methyl-1-(oxolan-2-ylmethyl)-6-[(5-oxo-4H-1,2,4-triazol-1-yl)methyl]-3-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(Cn2nc[nH]c2=O)sc2c1c(=O)n(CC(F)(F)F)c(=O)n2CC1CCCO1 |
| InChI | InChI=1S/C17H18F3N5O4S/c1-9-11(6-25-15(27)21-8-22-25)30-14-12(9)13(26)24(7-17(18,19)20)16(28)23(14)5-10-3-2-4-29-10/h8,10H,2-7H2,1H3,(H,21,22,27) |
| InChIKey | LWZQNQKTRGJCLX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |