C23H28F6N4O6S — CID 140848227
tert-butyl N-[3-ethoxyprop-2-enoyl-[[5-methyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]carbamate (PubChem CID 140848227) has the molecular formula C23H28F6N4O6S and a molecular weight of 602.55 g/mol. Its IUPAC name is tert-butyl N-[3-ethoxyprop-2-enoyl-[[5-methyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]carbamate.
| Compound Name | tert-butyl N-[3-ethoxyprop-2-enoyl-[[5-methyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]carbamate |
|---|---|
| PubChem CID | 140848227 |
| Molecular Formula | C23H28F6N4O6S |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | tert-butyl N-[3-ethoxyprop-2-enoyl-[[5-methyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]carbamate |
| SMILES | CCOC=CC(=O)N(Cc1sc2c(c1C)c(=O)n(CC(F)(F)F)c(=O)n2CCC(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H28F6N4O6S/c1-6-38-10-7-15(34)33(30-19(36)39-21(3,4)5)11-14-13(2)16-17(35)32(12-23(27,28)29)20(37)31(18(16)40-14)9-8-22(24,25)26/h7,10H,6,8-9,11-12H2,1-5H3,(H,30,36) |
| InChIKey | LHFCEIGHPIDSKU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|