C24H33F3N4O6S — CID 122574921
tert-butyl-[3-ethoxyprop-2-enoyl-[[5-methyl-2,4-dioxo-3-propan-2-yl-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]carbamic acid (PubChem CID 122574921) has the molecular formula C24H33F3N4O6S and a molecular weight of 562.61 g/mol. Its IUPAC name is tert-butyl-[3-ethoxyprop-2-enoyl-[[5-methyl-2,4-dioxo-3-propan-2-yl-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]carbamic acid.
| Compound Name | tert-butyl-[3-ethoxyprop-2-enoyl-[[5-methyl-2,4-dioxo-3-propan-2-yl-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]carbamic acid |
|---|---|
| PubChem CID | 122574921 |
| Molecular Formula | C24H33F3N4O6S |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | tert-butyl-[3-ethoxyprop-2-enoyl-[[5-methyl-2,4-dioxo-3-propan-2-yl-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]carbamic acid |
| SMILES | CCOC=CC(=O)N(Cc1sc2c(c1C)c(=O)n(C(C)C)c(=O)n2CCC(F)(F)F)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C24H33F3N4O6S/c1-8-37-12-9-17(32)29(31(22(35)36)23(5,6)7)13-16-15(4)18-19(33)30(14(2)3)21(34)28(20(18)38-16)11-10-24(25,26)27/h9,12,14H,8,10-11,13H2,1-7H3,(H,35,36) |
| InChIKey | BBNGYCUXFZIQOD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|