About 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol
1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol (PubChem CID 134385792) has the molecular formula C12H27NO2
and a molecular weight of 217.35 g/mol. Its IUPAC name is 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol |
| PubChem CID | 134385792 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol |
| SMILES | CC(CCN)CC(C)(C)OCC(C)(C)O |
| InChI | InChI=1S/C12H27NO2/c1-10(6-7-13)8-12(4,5)15-9-11(2,3)14/h10,14H,6-9,13H2,1-5H3 |
| InChIKey | REQINFWQRKCYIY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol?
The IUPAC name of 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol (CID 134385792) is 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol.
What is the SMILES notation for 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol?
The canonical SMILES for 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol is CC(CCN)CC(C)(C)OCC(C)(C)O.
What is the InChIKey of 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol?
The InChIKey is REQINFWQRKCYIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO2/c1-10(6-7-13)8-12(4,5)15-9-11(2,3)14/h10,14H,6-9,13H2,1-5H3.
What are the key properties of 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol?
1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol has a molecular weight of 217.35 g/mol, XLogP of 1.93, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-2,4-dimethylhexan-2-yl)oxy-2-methylpropan-2-ol is sourced from PubChem (CID 134385792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).