C48H61N2O2+ — CID 134386028
(2,4-dimethylphenyl)-(2-ethylhexyl)-[4-[3-[4-[N-(2-ethylhexyl)-2,4-dimethylanilino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 134386028) has the molecular formula C48H61N2O2+ and a molecular weight of 698.03 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-(2-ethylhexyl)-[4-[3-[4-[N-(2-ethylhexyl)-2,4-dimethylanilino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | (2,4-dimethylphenyl)-(2-ethylhexyl)-[4-[3-[4-[N-(2-ethylhexyl)-2,4-dimethylanilino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 134386028 |
| Molecular Formula | C48H61N2O2+ |
| Molecular Weight | 698.03 g/mol |
| Exact Mass | 697.47 |
| IUPAC Name | (2,4-dimethylphenyl)-(2-ethylhexyl)-[4-[3-[4-[N-(2-ethylhexyl)-2,4-dimethylanilino]phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CCCCC(CC)CN(c1ccc(C2=C(O)C(=C3C=CC(=[N+](CC(CC)CCCC)c4ccc(C)cc4C)C=C3)C2=O)cc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C48H60N2O2/c1-9-13-15-37(11-3)31-49(43-27-17-33(5)29-35(43)7)41-23-19-39(20-24-41)45-47(51)46(48(45)52)40-21-25-42(26-22-40)50(32-38(12-4)16-14-10-2)44-28-18-34(6)30-36(44)8/h17-30,37-38H,9-16,31-32H2,1-8H3/p+1 |
| InChIKey | KOUWYKSMTPSXFD-UHFFFAOYSA-O |
| XLogP | 12.55 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.03 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|