C44H53N2O2+ — CID 142310201
(2,4-dimethylphenyl)-hexan-3-yl-[4-[3-[4-(N-hexan-3-yl-2,4-dimethylanilino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 142310201) has the molecular formula C44H53N2O2+ and a molecular weight of 641.92 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-hexan-3-yl-[4-[3-[4-(N-hexan-3-yl-2,4-dimethylanilino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | (2,4-dimethylphenyl)-hexan-3-yl-[4-[3-[4-(N-hexan-3-yl-2,4-dimethylanilino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 142310201 |
| Molecular Formula | C44H53N2O2+ |
| Molecular Weight | 641.92 g/mol |
| Exact Mass | 641.41 |
| IUPAC Name | (2,4-dimethylphenyl)-hexan-3-yl-[4-[3-[4-(N-hexan-3-yl-2,4-dimethylanilino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CCCC(CC)N(c1ccc(C2=C(O)C(=C3C=CC(=[N+](c4ccc(C)cc4C)C(CC)CCC)C=C3)C2=O)cc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C44H52N2O2/c1-9-13-35(11-3)45(39-25-15-29(5)27-31(39)7)37-21-17-33(18-22-37)41-43(47)42(44(41)48)34-19-23-38(24-20-34)46(36(12-4)14-10-2)40-26-16-30(6)28-32(40)8/h15-28,35-36H,9-14H2,1-8H3/p+1 |
| InChIKey | IDBPDFFZPLSUNI-UHFFFAOYSA-O |
| XLogP | 11.28 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.92 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|