C23H37NO7 — CID 134387319
[3-(2-methoxyphenoxy)-2-(2-methyl-3-oxo-8-propan-2-yloxyoctan-2-yl)oxypropyl] carbamate (PubChem CID 134387319) has the molecular formula C23H37NO7 and a molecular weight of 439.55 g/mol. Its IUPAC name is [3-(2-methoxyphenoxy)-2-(2-methyl-3-oxo-8-propan-2-yloxyoctan-2-yl)oxypropyl] carbamate.
| Compound Name | [3-(2-methoxyphenoxy)-2-(2-methyl-3-oxo-8-propan-2-yloxyoctan-2-yl)oxypropyl] carbamate |
|---|---|
| PubChem CID | 134387319 |
| Molecular Formula | C23H37NO7 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | [3-(2-methoxyphenoxy)-2-(2-methyl-3-oxo-8-propan-2-yloxyoctan-2-yl)oxypropyl] carbamate |
| SMILES | COc1ccccc1OCC(COC(N)=O)OC(C)(C)C(=O)CCCCCOC(C)C |
| InChI | InChI=1S/C23H37NO7/c1-17(2)28-14-10-6-7-13-21(25)23(3,4)31-18(16-30-22(24)26)15-29-20-12-9-8-11-19(20)27-5/h8-9,11-12,17-18H,6-7,10,13-16H2,1-5H3,(H2,24,26) |
| InChIKey | ACPQRFHJCZHRKU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|