C7H12N3O2+ — CID 134387922
2-[3-(2-aminoethyl)imidazol-1-ium-1-yl]acetic acid (PubChem CID 134387922) has the molecular formula C7H12N3O2+ and a molecular weight of 170.19 g/mol. Its IUPAC name is 2-[3-(2-aminoethyl)imidazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[3-(2-aminoethyl)imidazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 134387922 |
| Molecular Formula | C7H12N3O2+ |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-[3-(2-aminoethyl)imidazol-1-ium-1-yl]acetic acid |
| SMILES | NCCn1cc[n+](CC(=O)O)c1 |
| InChI | InChI=1S/C7H11N3O2/c8-1-2-9-3-4-10(6-9)5-7(11)12/h3-4,6H,1-2,5,8H2/p+1 |
| InChIKey | IPDHSCVSEUNTMF-UHFFFAOYSA-O |
| XLogP | -1.18 |
| TPSA | 72.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|