2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide

C7H9BrN2O4 — CID 162515239

IUPAC2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide
SMILESO=C(O)Cn1cc[n+](CC(=O)O)c1.[Br-]
InChIInChI=1S/C7H8N2O4.BrH/c10-6(11)3-8-1-2-9(5-8)4-7(12)13;/h1-2,5H,3-4H2,(H-,10,11,12,13);1H
InChIKeyHWSLHVOBJMARBN-UHFFFAOYSA-N
MW265.06 g/mol
LogP-4.05
Rot. Bonds4

About 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide

2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide (PubChem CID 162515239) has the molecular formula C7H9BrN2O4 and a molecular weight of 265.06 g/mol. Its IUPAC name is 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide.

Molecular Properties

Compound Name2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide
PubChem CID162515239
Molecular FormulaC7H9BrN2O4
Molecular Weight265.06 g/mol
Exact Mass263.97
IUPAC Name2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide
SMILESO=C(O)Cn1cc[n+](CC(=O)O)c1.[Br-]
InChIInChI=1S/C7H8N2O4.BrH/c10-6(11)3-8-1-2-9(5-8)4-7(12)13;/h1-2,5H,3-4H2,(H-,10,11,12,13);1H
InChIKeyHWSLHVOBJMARBN-UHFFFAOYSA-N
XLogP-4.05
TPSA83.41 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.06
LogP ≤ 5-4.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide?
The IUPAC name of 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide (CID 162515239) is 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide.
What is the SMILES notation for 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide?
The canonical SMILES for 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide is O=C(O)Cn1cc[n+](CC(=O)O)c1.[Br-].
What is the InChIKey of 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide?
The InChIKey is HWSLHVOBJMARBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4.BrH/c10-6(11)3-8-1-2-9(5-8)4-7(12)13;/h1-2,5H,3-4H2,(H-,10,11,12,13);1H.
What are the key properties of 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide?
2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide has a molecular weight of 265.06 g/mol, XLogP of -4.05, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide is sourced from PubChem (CID 162515239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).