C7H9BrN2O4 — CID 162515239
2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide (PubChem CID 162515239) has the molecular formula C7H9BrN2O4 and a molecular weight of 265.06 g/mol. Its IUPAC name is 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide.
| Compound Name | 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide |
|---|---|
| PubChem CID | 162515239 |
| Molecular Formula | C7H9BrN2O4 |
| Molecular Weight | 265.06 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 2-[3-(carboxymethyl)imidazol-3-ium-1-yl]acetic acid bromide |
| SMILES | O=C(O)Cn1cc[n+](CC(=O)O)c1.[Br-] |
| InChI | InChI=1S/C7H8N2O4.BrH/c10-6(11)3-8-1-2-9(5-8)4-7(12)13;/h1-2,5H,3-4H2,(H-,10,11,12,13);1H |
| InChIKey | HWSLHVOBJMARBN-UHFFFAOYSA-N |
| XLogP | -4.05 |
| TPSA | 83.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.06 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|