C14H9NO — CID 13438851
1H-[1]benzofuro[3,2-g]indole (PubChem CID 13438851) has the molecular formula C14H9NO and a molecular weight of 207.23 g/mol. Its IUPAC name is 1H-[1]benzofuro[3,2-g]indole.
| Compound Name | 1H-[1]benzofuro[3,2-g]indole |
|---|---|
| PubChem CID | 13438851 |
| Molecular Formula | C14H9NO |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1H-[1]benzofuro[3,2-g]indole |
| SMILES | c1ccc2c(c1)oc1c2ccc2cc[nH]c21 |
| InChI | InChI=1S/C14H9NO/c1-2-4-12-10(3-1)11-6-5-9-7-8-15-13(9)14(11)16-12/h1-8,15H |
| InChIKey | RAOZCIPYWRYQKN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |