C60H79NO10 — CID 134389487
N-[(2S,3S,4R)-3,4-dihydroxy-1-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxynonan-2-yl]-3-(4-octoxyphenyl)propanamide (PubChem CID 134389487) has the molecular formula C60H79NO10 and a molecular weight of 974.29 g/mol. Its IUPAC name is N-[(2S,3S,4R)-3,4-dihydroxy-1-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxynonan-2-yl]-3-(4-octoxyphenyl)propanamide.
| Compound Name | N-[(2S,3S,4R)-3,4-dihydroxy-1-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxynonan-2-yl]-3-(4-octoxyphenyl)propanamide |
|---|---|
| PubChem CID | 134389487 |
| Molecular Formula | C60H79NO10 |
| Molecular Weight | 974.29 g/mol |
| Exact Mass | 973.57 |
| IUPAC Name | N-[(2S,3S,4R)-3,4-dihydroxy-1-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxynonan-2-yl]-3-(4-octoxyphenyl)propanamide |
| SMILES | CCCCCCCCOc1ccc(CCC(=O)N[C@@H](COC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)[C@H](O)[C@H](O)CCCCC)cc1 |
| InChI | InChI=1S/C60H79NO10/c1-3-5-7-8-9-23-39-66-51-36-33-46(34-37-51)35-38-55(63)61-52(56(64)53(62)32-14-6-4-2)44-70-60-59(69-43-50-30-21-13-22-31-50)58(68-42-49-28-19-12-20-29-49)57(67-41-48-26-17-11-18-27-48)54(71-60)45-65-40-47-24-15-10-16-25-47/h10-13,15-22,24-31,33-34,36-37,52-54,56-60,62,64H,3-9,14,23,32,35,38-45H2,1-2H3,(H,61,63)/t52-,53+,54?,56-,57?,58?,59?,60?/m0/s1 |
| InChIKey | VTJNXNZGPDFCNZ-KRHVCMNJSA-N |
| XLogP | 10.86 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.29 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|