C13H21F2NO — CID 134389895
4-[3-(difluoromethoxy)-5,6-dimethylcyclohexa-1,3-dien-1-yl]butan-1-amine (PubChem CID 134389895) has the molecular formula C13H21F2NO and a molecular weight of 245.31 g/mol. Its IUPAC name is 4-[3-(difluoromethoxy)-5,6-dimethylcyclohexa-1,3-dien-1-yl]butan-1-amine.
| Compound Name | 4-[3-(difluoromethoxy)-5,6-dimethylcyclohexa-1,3-dien-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 134389895 |
| Molecular Formula | C13H21F2NO |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 4-[3-(difluoromethoxy)-5,6-dimethylcyclohexa-1,3-dien-1-yl]butan-1-amine |
| SMILES | CC1C=C(OC(F)F)C=C(CCCCN)C1C |
| InChI | InChI=1S/C13H21F2NO/c1-9-7-12(17-13(14)15)8-11(10(9)2)5-3-4-6-16/h7-10,13H,3-6,16H2,1-2H3 |
| InChIKey | WVYLJEQHEIPCHV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|