C30H31NO — CID 134390677
5-(4-phenylcyclohexa-1,5-dien-1-yl)-1,2,3,4,5a,7b,10,11,11a,12b-decahydro-[1]benzofuro[3,2-c]carbazole (PubChem CID 134390677) has the molecular formula C30H31NO and a molecular weight of 421.58 g/mol. Its IUPAC name is 5-(4-phenylcyclohexa-1,5-dien-1-yl)-1,2,3,4,5a,7b,10,11,11a,12b-decahydro-[1]benzofuro[3,2-c]carbazole.
| Compound Name | 5-(4-phenylcyclohexa-1,5-dien-1-yl)-1,2,3,4,5a,7b,10,11,11a,12b-decahydro-[1]benzofuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 134390677 |
| Molecular Formula | C30H31NO |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 5-(4-phenylcyclohexa-1,5-dien-1-yl)-1,2,3,4,5a,7b,10,11,11a,12b-decahydro-[1]benzofuro[3,2-c]carbazole |
| SMILES | C1=CC2C3=C(OC2CC1)C1C2=C(CCCC2)N(C2=CCC(c4ccccc4)C=C2)C1C=C3 |
| InChI | InChI=1S/C30H31NO/c1-2-8-20(9-3-1)21-14-16-22(17-15-21)31-26-12-6-4-11-25(26)29-27(31)19-18-24-23-10-5-7-13-28(23)32-30(24)29/h1-3,5,8-10,14,16-19,21,23,27-29H,4,6-7,11-13,15H2 |
| InChIKey | ZNZAYZSAUKLLEV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|