C46H48N4 — CID 163817350
3-[4-[6-[4-(1,2,3,4,4a,5,6,7,8,9a-decahydrocarbazol-9-yl)cyclohexa-2,4-dien-1-yl]-2-cyclohexa-1,3-dien-1-ylpyrimidin-4-yl]phenyl]-3,4,4a,9-tetrahydro-2H-carbazole (PubChem CID 163817350) has the molecular formula C46H48N4 and a molecular weight of 656.92 g/mol. Its IUPAC name is 3-[4-[6-[4-(1,2,3,4,4a,5,6,7,8,9a-decahydrocarbazol-9-yl)cyclohexa-2,4-dien-1-yl]-2-cyclohexa-1,3-dien-1-ylpyrimidin-4-yl]phenyl]-3,4,4a,9-tetrahydro-2H-carbazole.
| Compound Name | 3-[4-[6-[4-(1,2,3,4,4a,5,6,7,8,9a-decahydrocarbazol-9-yl)cyclohexa-2,4-dien-1-yl]-2-cyclohexa-1,3-dien-1-ylpyrimidin-4-yl]phenyl]-3,4,4a,9-tetrahydro-2H-carbazole |
|---|---|
| PubChem CID | 163817350 |
| Molecular Formula | C46H48N4 |
| Molecular Weight | 656.92 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | 3-[4-[6-[4-(1,2,3,4,4a,5,6,7,8,9a-decahydrocarbazol-9-yl)cyclohexa-2,4-dien-1-yl]-2-cyclohexa-1,3-dien-1-ylpyrimidin-4-yl]phenyl]-3,4,4a,9-tetrahydro-2H-carbazole |
| SMILES | C1=CCCC(c2nc(-c3ccc(C4CC=C5Nc6ccccc6C5C4)cc3)cc(C3C=CC(N4C5=C(CCCC5)C5CCCCC54)=CC3)n2)=C1 |
| InChI | InChI=1S/C46H48N4/c1-2-10-33(11-3-1)46-48-42(31-20-18-30(19-21-31)34-24-27-41-39(28-34)36-12-4-7-15-40(36)47-41)29-43(49-46)32-22-25-35(26-23-32)50-44-16-8-5-13-37(44)38-14-6-9-17-45(38)50/h1-2,4,7,10,12,15,18-22,25-27,29,32,34,37,39,44,47H,3,5-6,8-9,11,13-14,16-17,23-24,28H2 |
| InChIKey | NSLWGHABTAVAAZ-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.92 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |