C43H37N3O — CID 168740042
2-[4-(4,4a,5,6-tetrahydronaphthalen-2-yl)phenyl]-4-(1,9b-dihydrodibenzofuran-3-yl)-6-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine (PubChem CID 168740042) has the molecular formula C43H37N3O and a molecular weight of 611.79 g/mol. Its IUPAC name is 2-[4-(4,4a,5,6-tetrahydronaphthalen-2-yl)phenyl]-4-(1,9b-dihydrodibenzofuran-3-yl)-6-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine.
| Compound Name | 2-[4-(4,4a,5,6-tetrahydronaphthalen-2-yl)phenyl]-4-(1,9b-dihydrodibenzofuran-3-yl)-6-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168740042 |
| Molecular Formula | C43H37N3O |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 2-[4-(4,4a,5,6-tetrahydronaphthalen-2-yl)phenyl]-4-(1,9b-dihydrodibenzofuran-3-yl)-6-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine |
| SMILES | C1=CCCC(C2=CC=C(c3nc(C4=CCC5C(=C4)Oc4ccccc45)nc(-c4ccc(C5=CCC6CCC=CC6=C5)cc4)n3)CC2)=C1 |
| InChI | InChI=1S/C43H37N3O/c1-2-8-28(9-3-1)30-14-19-32(20-15-30)41-44-42(33-21-16-31(17-22-33)35-23-18-29-10-4-5-11-34(29)26-35)46-43(45-41)36-24-25-38-37-12-6-7-13-39(37)47-40(38)27-36/h1-2,5-8,11-14,16-17,19,21-24,26-27,29,38H,3-4,9-10,15,18,20,25H2 |
| InChIKey | BTJIIKRSBMBKRI-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |