C20H19FN4O3S — CID 134393628
N-(benzenesulfinyl)-2-fluoro-6-[3-[(1-methylcyclopropyl)methoxy]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 134393628) has the molecular formula C20H19FN4O3S and a molecular weight of 414.46 g/mol. Its IUPAC name is N-(benzenesulfinyl)-2-fluoro-6-[3-[(1-methylcyclopropyl)methoxy]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(benzenesulfinyl)-2-fluoro-6-[3-[(1-methylcyclopropyl)methoxy]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134393628 |
| Molecular Formula | C20H19FN4O3S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-(benzenesulfinyl)-2-fluoro-6-[3-[(1-methylcyclopropyl)methoxy]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | CC1(COc2ccn(-c3ccc(C(=O)NS(=O)c4ccccc4)c(F)n3)n2)CC1 |
| InChI | InChI=1S/C20H19FN4O3S/c1-20(10-11-20)13-28-17-9-12-25(23-17)16-8-7-15(18(21)22-16)19(26)24-29(27)14-5-3-2-4-6-14/h2-9,12H,10-11,13H2,1H3,(H,24,26) |
| InChIKey | ODAAHWIQLBPRMW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|