C11H17N3OS — CID 134394885
4-(1,3-thiazol-2-yl)-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 134394885) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yl)-1-oxa-4,9-diazaspiro[5.5]undecane.
| Compound Name | 4-(1,3-thiazol-2-yl)-1-oxa-4,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 134394885 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-(1,3-thiazol-2-yl)-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | c1csc(N2CCOC3(CCNCC3)C2)n1 |
| InChI | InChI=1S/C11H17N3OS/c1-3-12-4-2-11(1)9-14(6-7-15-11)10-13-5-8-16-10/h5,8,12H,1-4,6-7,9H2 |
| InChIKey | YWPXUOZGWMFSIU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |