C46H33N3OP+ — CID 134395964
22-(4-cyclohexa-1,3-dien-1-ylquinazolin-2-yl)-8-hydroxy-8-(3-phenylphenyl)-22-aza-8-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene (PubChem CID 134395964) has the molecular formula C46H33N3OP+ and a molecular weight of 674.76 g/mol. Its IUPAC name is 22-(4-cyclohexa-1,3-dien-1-ylquinazolin-2-yl)-8-hydroxy-8-(3-phenylphenyl)-22-aza-8-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene.
| Compound Name | 22-(4-cyclohexa-1,3-dien-1-ylquinazolin-2-yl)-8-hydroxy-8-(3-phenylphenyl)-22-aza-8-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene |
|---|---|
| PubChem CID | 134395964 |
| Molecular Formula | C46H33N3OP+ |
| Molecular Weight | 674.76 g/mol |
| Exact Mass | 674.24 |
| IUPAC Name | 22-(4-cyclohexa-1,3-dien-1-ylquinazolin-2-yl)-8-hydroxy-8-(3-phenylphenyl)-22-aza-8-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene |
| SMILES | O[P+]1(c2cccc(-c3ccccc3)c2)c2ccccc2-c2c(n(-c3nc(C4=CC=CCC4)c4ccccc4n3)c3ccccc23)-c2ccccc21 |
| InChI | InChI=1S/C46H33N3OP/c50-51(34-21-15-20-33(30-34)31-16-3-1-4-17-31)41-28-13-9-24-37(41)43-36-23-8-12-27-40(36)49(45(43)38-25-10-14-29-42(38)51)46-47-39-26-11-7-22-35(39)44(48-46)32-18-5-2-6-19-32/h1-5,7-18,20-30,50H,6,19H2/q+1 |
| InChIKey | RVDBGKCOCHOVFW-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.76 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|