C51H38N2OP+ — CID 134395969
8-hydroxy-22-[3-(3-methyl-2,7-diphenyl-3H-azepin-5-yl)phenyl]-8-phenyl-22-aza-8-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene (PubChem CID 134395969) has the molecular formula C51H38N2OP+ and a molecular weight of 725.85 g/mol. Its IUPAC name is 8-hydroxy-22-[3-(3-methyl-2,7-diphenyl-3H-azepin-5-yl)phenyl]-8-phenyl-22-aza-8-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene.
| Compound Name | 8-hydroxy-22-[3-(3-methyl-2,7-diphenyl-3H-azepin-5-yl)phenyl]-8-phenyl-22-aza-8-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene |
|---|---|
| PubChem CID | 134395969 |
| Molecular Formula | C51H38N2OP+ |
| Molecular Weight | 725.85 g/mol |
| Exact Mass | 725.27 |
| IUPAC Name | 8-hydroxy-22-[3-(3-methyl-2,7-diphenyl-3H-azepin-5-yl)phenyl]-8-phenyl-22-aza-8-phosphoniapentacyclo[13.7.0.02,7.09,14.016,21]docosa-1(15),2,4,6,9,11,13,16,18,20-decaene |
| SMILES | CC1C=C(c2cccc(-n3c4c(c5ccccc53)-c3ccccc3[P+](O)(c3ccccc3)c3ccccc3-4)c2)C=C(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C51H38N2OP/c1-35-32-39(34-45(36-18-5-2-6-19-36)52-50(35)37-20-7-3-8-21-37)38-22-17-23-40(33-38)53-46-29-14-11-26-42(46)49-43-27-12-15-30-47(43)55(54,41-24-9-4-10-25-41)48-31-16-13-28-44(48)51(49)53/h2-35,54H,1H3/q+1 |
| InChIKey | IWQAWUAMANCYFQ-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.85 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|