C18H13FN6O — CID 134398133
4-[2-[(3R)-1-cyano-3-fluoropiperidin-3-yl]-[1,3]oxazolo[5,4-b]pyridin-6-yl]pyridine-2-carbonitrile (PubChem CID 134398133) has the molecular formula C18H13FN6O and a molecular weight of 348.34 g/mol. Its IUPAC name is 4-[2-[(3R)-1-cyano-3-fluoropiperidin-3-yl]-[1,3]oxazolo[5,4-b]pyridin-6-yl]pyridine-2-carbonitrile.
| Compound Name | 4-[2-[(3R)-1-cyano-3-fluoropiperidin-3-yl]-[1,3]oxazolo[5,4-b]pyridin-6-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 134398133 |
| Molecular Formula | C18H13FN6O |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-[2-[(3R)-1-cyano-3-fluoropiperidin-3-yl]-[1,3]oxazolo[5,4-b]pyridin-6-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(-c2cnc3oc([C@@]4(F)CCCN(C#N)C4)nc3c2)ccn1 |
| InChI | InChI=1S/C18H13FN6O/c19-18(3-1-5-25(10-18)11-21)17-24-15-7-13(9-23-16(15)26-17)12-2-4-22-14(6-12)8-20/h2,4,6-7,9H,1,3,5,10H2/t18-/m1/s1 |
| InChIKey | PSFHWQSIAPFHKC-GOSISDBHSA-N |
| XLogP | 2.90 |
| TPSA | 102.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|