C23H21FN4O — CID 71292341
2-[4-[4-[(6-fluoro-3-pyridinyl)methyl]piperazin-1-yl]phenyl]-1,3-benzoxazole (PubChem CID 71292341) has the molecular formula C23H21FN4O and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-[4-[4-[(6-fluoro-3-pyridinyl)methyl]piperazin-1-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[4-[(6-fluoro-3-pyridinyl)methyl]piperazin-1-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 71292341 |
| Molecular Formula | C23H21FN4O |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[4-[4-[(6-fluoro-3-pyridinyl)methyl]piperazin-1-yl]phenyl]-1,3-benzoxazole |
| SMILES | Fc1ccc(CN2CCN(c3ccc(-c4nc5ccccc5o4)cc3)CC2)cn1 |
| InChI | InChI=1S/C23H21FN4O/c24-22-10-5-17(15-25-22)16-27-11-13-28(14-12-27)19-8-6-18(7-9-19)23-26-20-3-1-2-4-21(20)29-23/h1-10,15H,11-14,16H2 |
| InChIKey | VQIPFMOEPPWFRZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|