C22H25N5O2S — CID 134398567
6-(5-oxo-1H-pyrazol-2-yl)-N-phenylsulfanyl-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide (PubChem CID 134398567) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is 6-(5-oxo-1H-pyrazol-2-yl)-N-phenylsulfanyl-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide.
| Compound Name | 6-(5-oxo-1H-pyrazol-2-yl)-N-phenylsulfanyl-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134398567 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 6-(5-oxo-1H-pyrazol-2-yl)-N-phenylsulfanyl-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1CN(c2nc(-n3ccc(=O)[nH]3)ccc2C(=O)NSc2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C22H25N5O2S/c1-15-13-22(2,3)26(14-15)20-17(21(29)25-30-16-7-5-4-6-8-16)9-10-18(23-20)27-12-11-19(28)24-27/h4-12,15H,13-14H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | KAIDKWFVLNWOFA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|