C23H28ClN7O2S — CID 139428802
2-chloro-N-[[6-[3-(5,5-dimethylpyrrolidin-3-yl)propylamino]-2-pyridinyl]sulfanyl]-6-(5-oxo-1H-pyrazol-2-yl)pyridine-3-carboxamide (PubChem CID 139428802) has the molecular formula C23H28ClN7O2S and a molecular weight of 502.04 g/mol. Its IUPAC name is 2-chloro-N-[[6-[3-(5,5-dimethylpyrrolidin-3-yl)propylamino]-2-pyridinyl]sulfanyl]-6-(5-oxo-1H-pyrazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[6-[3-(5,5-dimethylpyrrolidin-3-yl)propylamino]-2-pyridinyl]sulfanyl]-6-(5-oxo-1H-pyrazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139428802 |
| Molecular Formula | C23H28ClN7O2S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 2-chloro-N-[[6-[3-(5,5-dimethylpyrrolidin-3-yl)propylamino]-2-pyridinyl]sulfanyl]-6-(5-oxo-1H-pyrazol-2-yl)pyridine-3-carboxamide |
| SMILES | CC1(C)CC(CCCNc2cccc(SNC(=O)c3ccc(-n4ccc(=O)[nH]4)nc3Cl)n2)CN1 |
| InChI | InChI=1S/C23H28ClN7O2S/c1-23(2)13-15(14-26-23)5-4-11-25-17-6-3-7-20(27-17)34-30-22(33)16-8-9-18(28-21(16)24)31-12-10-19(32)29-31/h3,6-10,12,15,26H,4-5,11,13-14H2,1-2H3,(H,25,27)(H,29,32)(H,30,33) |
| InChIKey | SPDZSHDLAKLIFX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|