C31H42ClN7O4S — CID 160827293
2-chloro-N-[[6-[5-(5,5-dimethylpyrrolidin-3-yl)pentylamino]-2-pyridinyl]sulfonyl]-6-[3-[2-(1-methylcyclopropyl)ethoxy]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 160827293) has the molecular formula C31H42ClN7O4S and a molecular weight of 644.24 g/mol. Its IUPAC name is 2-chloro-N-[[6-[5-(5,5-dimethylpyrrolidin-3-yl)pentylamino]-2-pyridinyl]sulfonyl]-6-[3-[2-(1-methylcyclopropyl)ethoxy]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[6-[5-(5,5-dimethylpyrrolidin-3-yl)pentylamino]-2-pyridinyl]sulfonyl]-6-[3-[2-(1-methylcyclopropyl)ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 160827293 |
| Molecular Formula | C31H42ClN7O4S |
| Molecular Weight | 644.24 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | 2-chloro-N-[[6-[5-(5,5-dimethylpyrrolidin-3-yl)pentylamino]-2-pyridinyl]sulfonyl]-6-[3-[2-(1-methylcyclopropyl)ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | CC1(CCOc2ccn(-c3ccc(C(=O)NS(=O)(=O)c4cccc(NCCCCCC5CNC(C)(C)C5)n4)c(Cl)n3)n2)CC1 |
| InChI | InChI=1S/C31H42ClN7O4S/c1-30(2)20-22(21-34-30)8-5-4-6-17-33-24-9-7-10-27(35-24)44(41,42)38-29(40)23-11-12-25(36-28(23)32)39-18-13-26(37-39)43-19-16-31(3)14-15-31/h7,9-13,18,22,34H,4-6,8,14-17,19-21H2,1-3H3,(H,33,35)(H,38,40) |
| InChIKey | UPUQWRRBEVBGOW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.24 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|