C31H41ClN6O4S — CID 157370381
2-chloro-N-[[6-[4-(3,3-dimethylcyclopentyl)butylamino]-2-pyridinyl]sulfonyl]-6-[3-[2-(1-methylcyclopropyl)ethoxy]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 157370381) has the molecular formula C31H41ClN6O4S and a molecular weight of 629.23 g/mol. Its IUPAC name is 2-chloro-N-[[6-[4-(3,3-dimethylcyclopentyl)butylamino]-2-pyridinyl]sulfonyl]-6-[3-[2-(1-methylcyclopropyl)ethoxy]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[6-[4-(3,3-dimethylcyclopentyl)butylamino]-2-pyridinyl]sulfonyl]-6-[3-[2-(1-methylcyclopropyl)ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 157370381 |
| Molecular Formula | C31H41ClN6O4S |
| Molecular Weight | 629.23 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 2-chloro-N-[[6-[4-(3,3-dimethylcyclopentyl)butylamino]-2-pyridinyl]sulfonyl]-6-[3-[2-(1-methylcyclopropyl)ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | CC1(C)CCC(CCCCNc2cccc(S(=O)(=O)NC(=O)c3ccc(-n4ccc(OCCC5(C)CC5)n4)nc3Cl)n2)C1 |
| InChI | InChI=1S/C31H41ClN6O4S/c1-30(2)14-12-22(21-30)7-4-5-18-33-24-8-6-9-27(34-24)43(40,41)37-29(39)23-10-11-25(35-28(23)32)38-19-13-26(36-38)42-20-17-31(3)15-16-31/h6,8-11,13,19,22H,4-5,7,12,14-18,20-21H2,1-3H3,(H,33,34)(H,37,39) |
| InChIKey | FEVJDZKGAPCFNP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.23 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|