C21H26Cl2N4O3S — CID 160533245
2,6-dichloro-N-[[6-[3-[(1S)-3,3-dimethylcyclopentyl]propylamino]-2-pyridinyl]sulfonyl]pyridine-3-carboxamide (PubChem CID 160533245) has the molecular formula C21H26Cl2N4O3S and a molecular weight of 485.44 g/mol. Its IUPAC name is 2,6-dichloro-N-[[6-[3-[(1S)-3,3-dimethylcyclopentyl]propylamino]-2-pyridinyl]sulfonyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[[6-[3-[(1S)-3,3-dimethylcyclopentyl]propylamino]-2-pyridinyl]sulfonyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 160533245 |
| Molecular Formula | C21H26Cl2N4O3S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2,6-dichloro-N-[[6-[3-[(1S)-3,3-dimethylcyclopentyl]propylamino]-2-pyridinyl]sulfonyl]pyridine-3-carboxamide |
| SMILES | CC1(C)CC[C@@H](CCCNc2cccc(S(=O)(=O)NC(=O)c3ccc(Cl)nc3Cl)n2)C1 |
| InChI | InChI=1S/C21H26Cl2N4O3S/c1-21(2)11-10-14(13-21)5-4-12-24-17-6-3-7-18(26-17)31(29,30)27-20(28)15-8-9-16(22)25-19(15)23/h3,6-9,14H,4-5,10-13H2,1-2H3,(H,24,26)(H,27,28)/t14-/m1/s1 |
| InChIKey | RCVCZDKDYYEVQZ-CQSZACIVSA-N |
| XLogP | 4.92 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|